C16H25ClO6 — CID 25023423
(6S,6aR,8R,9R,10aS,10bR)-6-chloro-8,9-dimethoxy-2,2,8,9-tetramethyl-6,6a,10a,10b-tetrahydro-4H-[1,4]dioxino[2,3-h][1,3]benzodioxine (PubChem CID 25023423) has the molecular formula C16H25ClO6 and a molecular weight of 348.82 g/mol. Its IUPAC name is (6S,6aR,8R,9R,10aS,10bR)-6-chloro-8,9-dimethoxy-2,2,8,9-tetramethyl-6,6a,10a,10b-tetrahydro-4H-[1,4]dioxino[2,3-h][1,3]benzodioxine.
| Compound Name | (6S,6aR,8R,9R,10aS,10bR)-6-chloro-8,9-dimethoxy-2,2,8,9-tetramethyl-6,6a,10a,10b-tetrahydro-4H-[1,4]dioxino[2,3-h][1,3]benzodioxine |
|---|---|
| PubChem CID | 25023423 |
| Molecular Formula | C16H25ClO6 |
| Molecular Weight | 348.82 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | (6S,6aR,8R,9R,10aS,10bR)-6-chloro-8,9-dimethoxy-2,2,8,9-tetramethyl-6,6a,10a,10b-tetrahydro-4H-[1,4]dioxino[2,3-h][1,3]benzodioxine |
| SMILES | CO[C@]1(C)O[C@@H]2[C@@H](O[C@@]1(C)OC)[C@@H](Cl)C=C1COC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C16H25ClO6/c1-14(2)20-8-9-7-10(17)12-13(11(9)21-14)23-16(4,19-6)15(3,18-5)22-12/h7,10-13H,8H2,1-6H3/t10-,11+,12-,13-,15+,16+/m0/s1 |
| InChIKey | COGVXOKUAPXPBT-LQTRTAQESA-N |
| XLogP | 2.19 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.82 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|