C10H16O5S — CID 56958323
[(7R,7aS)-4a-hydroxy-2,2-dimethyl-4,6,7,7a-tetrahydrothieno[3,2-d][1,3]dioxin-7-yl] acetate (PubChem CID 56958323) has the molecular formula C10H16O5S and a molecular weight of 248.30 g/mol. Its IUPAC name is [(7R,7aS)-4a-hydroxy-2,2-dimethyl-4,6,7,7a-tetrahydrothieno[3,2-d][1,3]dioxin-7-yl] acetate.
| Compound Name | [(7R,7aS)-4a-hydroxy-2,2-dimethyl-4,6,7,7a-tetrahydrothieno[3,2-d][1,3]dioxin-7-yl] acetate |
|---|---|
| PubChem CID | 56958323 |
| Molecular Formula | C10H16O5S |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | [(7R,7aS)-4a-hydroxy-2,2-dimethyl-4,6,7,7a-tetrahydrothieno[3,2-d][1,3]dioxin-7-yl] acetate |
| SMILES | CC(=O)O[C@H]1CSC2(O)COC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C10H16O5S/c1-6(11)14-7-4-16-10(12)5-13-9(2,3)15-8(7)10/h7-8,12H,4-5H2,1-3H3/t7-,8-,10?/m0/s1 |
| InChIKey | ONEPNDFPPNHCJI-JIBHNJPVSA-N |
| XLogP | 0.50 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |