C6H10O3 — CID 70466682
2,2-dimethyl-4H-1,3-dioxin-4-ol (PubChem CID 70466682) has the molecular formula C6H10O3 and a molecular weight of 130.14 g/mol. Its IUPAC name is 2,2-dimethyl-4H-1,3-dioxin-4-ol.
| Compound Name | 2,2-dimethyl-4H-1,3-dioxin-4-ol |
|---|---|
| PubChem CID | 70466682 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | 2,2-dimethyl-4H-1,3-dioxin-4-ol |
| SMILES | CC1(C)OC=CC(O)O1 |
| InChI | InChI=1S/C6H10O3/c1-6(2)8-4-3-5(7)9-6/h3-5,7H,1-2H3 |
| InChIKey | IGNCDMZRZVOVSD-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |