C27H26N6O5S — CID 10209308
4-tert-butyl-N-[5-(2-methoxyphenoxy)-6-prop-2-ynoxy-2-pyrimidin-2-ylpyrimidin-4-yl]pyridine-2-sulfonamide (PubChem CID 10209308) has the molecular formula C27H26N6O5S and a molecular weight of 546.61 g/mol. Its IUPAC name is 4-tert-butyl-N-[5-(2-methoxyphenoxy)-6-prop-2-ynoxy-2-pyrimidin-2-ylpyrimidin-4-yl]pyridine-2-sulfonamide.
| Compound Name | 4-tert-butyl-N-[5-(2-methoxyphenoxy)-6-prop-2-ynoxy-2-pyrimidin-2-ylpyrimidin-4-yl]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 10209308 |
| Molecular Formula | C27H26N6O5S |
| Molecular Weight | 546.61 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | 4-tert-butyl-N-[5-(2-methoxyphenoxy)-6-prop-2-ynoxy-2-pyrimidin-2-ylpyrimidin-4-yl]pyridine-2-sulfonamide |
| SMILES | C#CCOc1nc(-c2ncccn2)nc(NS(=O)(=O)c2cc(C(C)(C)C)ccn2)c1Oc1ccccc1OC |
| InChI | InChI=1S/C27H26N6O5S/c1-6-16-37-26-22(38-20-11-8-7-10-19(20)36-5)23(31-25(32-26)24-29-13-9-14-30-24)33-39(34,35)21-17-18(12-15-28-21)27(2,3)4/h1,7-15,17H,16H2,2-5H3,(H,31,32,33) |
| InChIKey | ZZGZSTLQVNKFAH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 138.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.61 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|