About CID 102093735
CID 102093735 (PubChem CID 102093735) has the molecular formula C9H13N2
and a molecular weight of 149.22 g/mol.
Molecular Properties
| Compound Name | CID 102093735 |
| PubChem CID | 102093735 |
| Molecular Formula | C9H13N2 |
| Molecular Weight | 149.22 g/mol |
| Exact Mass | 149.11 |
| IUPAC Name | — |
| SMILES | C[C](C)c1cc(N)cc(N)c1 |
| InChI | InChI=1S/C9H13N2/c1-6(2)7-3-8(10)5-9(11)4-7/h3-5H,10-11H2,1-2H3 |
| InChIKey | IYOQALGUYWMBPN-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.22 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze CID 102093735 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102093735?
The IUPAC name of CID 102093735 (CID 102093735) is not available.
What is the SMILES notation for CID 102093735?
The canonical SMILES for CID 102093735 is C[C](C)c1cc(N)cc(N)c1.
What is the InChIKey of CID 102093735?
The InChIKey is IYOQALGUYWMBPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N2/c1-6(2)7-3-8(10)5-9(11)4-7/h3-5H,10-11H2,1-2H3.
What are the key properties of CID 102093735?
CID 102093735 has a molecular weight of 149.22 g/mol, XLogP of 1.81, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102093735 is sourced from PubChem (CID 102093735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).