C11H24OSi — CID 102094952
[(2S,3R)-2,3-dipropyloxiran-2-yl]-trimethylsilane (PubChem CID 102094952) has the molecular formula C11H24OSi and a molecular weight of 200.40 g/mol. Its IUPAC name is [(2S,3R)-2,3-dipropyloxiran-2-yl]-trimethylsilane.
| Compound Name | [(2S,3R)-2,3-dipropyloxiran-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 102094952 |
| Molecular Formula | C11H24OSi |
| Molecular Weight | 200.40 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | [(2S,3R)-2,3-dipropyloxiran-2-yl]-trimethylsilane |
| SMILES | CCC[C@H]1O[C@@]1(CCC)[Si](C)(C)C |
| InChI | InChI=1S/C11H24OSi/c1-6-8-10-11(12-10,9-7-2)13(3,4)5/h10H,6-9H2,1-5H3/t10-,11+/m1/s1 |
| InChIKey | ZNJXCTAHGMQBIS-MNOVXSKESA-N |
| XLogP | 3.60 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|