C23H34B2N2O2 — CID 102097093
3-[5-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexyl]-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene (PubChem CID 102097093) has the molecular formula C23H34B2N2O2 and a molecular weight of 392.16 g/mol. Its IUPAC name is 3-[5-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexyl]-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene.
| Compound Name | 3-[5-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexyl]-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene |
|---|---|
| PubChem CID | 102097093 |
| Molecular Formula | C23H34B2N2O2 |
| Molecular Weight | 392.16 g/mol |
| Exact Mass | 392.28 |
| IUPAC Name | 3-[5-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexyl]-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene |
| SMILES | CC(C)CCCC(B1Nc2cccc3cccc(c23)N1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C23H34B2N2O2/c1-16(2)10-7-15-20(25-28-22(3,4)23(5,6)29-25)24-26-18-13-8-11-17-12-9-14-19(27-24)21(17)18/h8-9,11-14,16,20,26-27H,7,10,15H2,1-6H3 |
| InChIKey | OGSQEGLDPKEWCF-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.16 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|