C22H30B2N2O2 — CID 177440124
3-[2-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enyl]-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene (PubChem CID 177440124) has the molecular formula C22H30B2N2O2 and a molecular weight of 376.12 g/mol. Its IUPAC name is 3-[2-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enyl]-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene.
| Compound Name | 3-[2-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enyl]-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene |
|---|---|
| PubChem CID | 177440124 |
| Molecular Formula | C22H30B2N2O2 |
| Molecular Weight | 376.12 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | 3-[2-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enyl]-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene |
| SMILES | C=CCC(C)(CB1Nc2cccc3cccc(c23)N1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C22H30B2N2O2/c1-7-14-22(6,24-27-20(2,3)21(4,5)28-24)15-23-25-17-12-8-10-16-11-9-13-18(26-23)19(16)17/h7-13,25-26H,1,14-15H2,2-6H3 |
| InChIKey | YAVLNCJQUAMFJK-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.12 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|