C15H14BBrN2 — CID 143539452
3-[(3Z)-2-bromopenta-1,3-dien-3-yl]-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene (PubChem CID 143539452) has the molecular formula C15H14BBrN2 and a molecular weight of 313.01 g/mol. Its IUPAC name is 3-[(3Z)-2-bromopenta-1,3-dien-3-yl]-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene.
| Compound Name | 3-[(3Z)-2-bromopenta-1,3-dien-3-yl]-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene |
|---|---|
| PubChem CID | 143539452 |
| Molecular Formula | C15H14BBrN2 |
| Molecular Weight | 313.01 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 3-[(3Z)-2-bromopenta-1,3-dien-3-yl]-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene |
| SMILES | C=C(Br)/C(=C\C)B1Nc2cccc3cccc(c23)N1 |
| InChI | InChI=1S/C15H14BBrN2/c1-3-12(10(2)17)16-18-13-8-4-6-11-7-5-9-14(19-16)15(11)13/h3-9,18-19H,2H2,1H3/b12-3+ |
| InChIKey | TUVNUJXHBLFROQ-KGVSQERTSA-N |
| XLogP | 4.56 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.01 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|