C16H19BN2O — CID 154712387
5-(2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-3-yl)hexan-3-one (PubChem CID 154712387) has the molecular formula C16H19BN2O and a molecular weight of 266.15 g/mol. Its IUPAC name is 5-(2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-3-yl)hexan-3-one.
| Compound Name | 5-(2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-3-yl)hexan-3-one |
|---|---|
| PubChem CID | 154712387 |
| Molecular Formula | C16H19BN2O |
| Molecular Weight | 266.15 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 5-(2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-3-yl)hexan-3-one |
| SMILES | CCC(=O)CC(C)B1Nc2cccc3cccc(c23)N1 |
| InChI | InChI=1S/C16H19BN2O/c1-3-13(20)10-11(2)17-18-14-8-4-6-12-7-5-9-15(19-17)16(12)14/h4-9,11,18-19H,3,10H2,1-2H3 |
| InChIKey | QCCMLAHUOFHRQN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.15 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|