C17H24BIO2 — CID 134950559
2-[(2S)-2-(4-iodophenyl)pent-4-en-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 134950559) has the molecular formula C17H24BIO2 and a molecular weight of 398.09 g/mol. Its IUPAC name is 2-[(2S)-2-(4-iodophenyl)pent-4-en-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(2S)-2-(4-iodophenyl)pent-4-en-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 134950559 |
| Molecular Formula | C17H24BIO2 |
| Molecular Weight | 398.09 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 2-[(2S)-2-(4-iodophenyl)pent-4-en-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=CC[C@@](C)(B1OC(C)(C)C(C)(C)O1)c1ccc(I)cc1 |
| InChI | InChI=1S/C17H24BIO2/c1-7-12-17(6,13-8-10-14(19)11-9-13)18-20-15(2,3)16(4,5)21-18/h7-11H,1,12H2,2-6H3/t17-/m1/s1 |
| InChIKey | VDOXQQMXEWQCGN-QGZVFWFLSA-N |
| XLogP | 4.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.09 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|