C27H38B2O4 — CID 177461570
4,4,5,5-tetramethyl-2-[1-[4-(4-methylphenyl)phenyl]-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-1,3,2-dioxaborolane (PubChem CID 177461570) has the molecular formula C27H38B2O4 and a molecular weight of 448.22 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[1-[4-(4-methylphenyl)phenyl]-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[1-[4-(4-methylphenyl)phenyl]-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 177461570 |
| Molecular Formula | C27H38B2O4 |
| Molecular Weight | 448.22 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[1-[4-(4-methylphenyl)phenyl]-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-1,3,2-dioxaborolane |
| SMILES | Cc1ccc(-c2ccc(C(C)(B3OC(C)(C)C(C)(C)O3)B3OC(C)(C)C(C)(C)O3)cc2)cc1 |
| InChI | InChI=1S/C27H38B2O4/c1-19-11-13-20(14-12-19)21-15-17-22(18-16-21)27(10,28-30-23(2,3)24(4,5)31-28)29-32-25(6,7)26(8,9)33-29/h11-18H,1-10H3 |
| InChIKey | FWDNKWKQIWXGPJ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.22 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|