C21H31B2F3O4 — CID 154712177
4,4,5,5-tetramethyl-2-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[4-(trifluoromethyl)phenyl]ethyl]-1,3,2-dioxaborolane (PubChem CID 154712177) has the molecular formula C21H31B2F3O4 and a molecular weight of 426.09 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[4-(trifluoromethyl)phenyl]ethyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[4-(trifluoromethyl)phenyl]ethyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 154712177 |
| Molecular Formula | C21H31B2F3O4 |
| Molecular Weight | 426.09 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[4-(trifluoromethyl)phenyl]ethyl]-1,3,2-dioxaborolane |
| SMILES | CC(B1OC(C)(C)C(C)(C)O1)(B1OC(C)(C)C(C)(C)O1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H31B2F3O4/c1-16(2)17(3,4)28-22(27-16)20(9,23-29-18(5,6)19(7,8)30-23)14-10-12-15(13-11-14)21(24,25)26/h10-13H,1-9H3 |
| InChIKey | GLDQNEZNNLOAPR-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.09 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|