C13H16BF3O — CID 144628017
2,2,3,3-tetramethyl-1-[4-(trifluoromethyl)phenoxy]borirane (PubChem CID 144628017) has the molecular formula C13H16BF3O and a molecular weight of 256.08 g/mol. Its IUPAC name is 2,2,3,3-tetramethyl-1-[4-(trifluoromethyl)phenoxy]borirane.
| Compound Name | 2,2,3,3-tetramethyl-1-[4-(trifluoromethyl)phenoxy]borirane |
|---|---|
| PubChem CID | 144628017 |
| Molecular Formula | C13H16BF3O |
| Molecular Weight | 256.08 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 2,2,3,3-tetramethyl-1-[4-(trifluoromethyl)phenoxy]borirane |
| SMILES | CC1(C)B(Oc2ccc(C(F)(F)F)cc2)C1(C)C |
| InChI | InChI=1S/C13H16BF3O/c1-11(2)12(3,4)14(11)18-10-7-5-9(6-8-10)13(15,16)17/h5-8H,1-4H3 |
| InChIKey | OUYLKLQOKFOXNH-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.08 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|