C19H31B2NO4 — CID 102198588
4,4,5,5-tetramethyl-N-(4-methylphenyl)-N-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolan-2-amine (PubChem CID 102198588) has the molecular formula C19H31B2NO4 and a molecular weight of 359.08 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-N-(4-methylphenyl)-N-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolan-2-amine.
| Compound Name | 4,4,5,5-tetramethyl-N-(4-methylphenyl)-N-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolan-2-amine |
|---|---|
| PubChem CID | 102198588 |
| Molecular Formula | C19H31B2NO4 |
| Molecular Weight | 359.08 g/mol |
| Exact Mass | 359.24 |
| IUPAC Name | 4,4,5,5-tetramethyl-N-(4-methylphenyl)-N-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolan-2-amine |
| SMILES | Cc1ccc(N(B2OC(C)(C)C(C)(C)O2)B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C19H31B2NO4/c1-14-10-12-15(13-11-14)22(20-23-16(2,3)17(4,5)24-20)21-25-18(6,7)19(8,9)26-21/h10-13H,1-9H3 |
| InChIKey | XFLCQNGSXUEBPY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.08 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|