C22H30IN — CID 167114232
2-tert-butyl-6-[3-(4-iodophenyl)-2,3-dimethylbutan-2-yl]aniline (PubChem CID 167114232) has the molecular formula C22H30IN and a molecular weight of 435.39 g/mol. Its IUPAC name is 2-tert-butyl-6-[3-(4-iodophenyl)-2,3-dimethylbutan-2-yl]aniline.
| Compound Name | 2-tert-butyl-6-[3-(4-iodophenyl)-2,3-dimethylbutan-2-yl]aniline |
|---|---|
| PubChem CID | 167114232 |
| Molecular Formula | C22H30IN |
| Molecular Weight | 435.39 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 2-tert-butyl-6-[3-(4-iodophenyl)-2,3-dimethylbutan-2-yl]aniline |
| SMILES | CC(C)(C)c1cccc(C(C)(C)C(C)(C)c2ccc(I)cc2)c1N |
| InChI | InChI=1S/C22H30IN/c1-20(2,3)17-9-8-10-18(19(17)24)22(6,7)21(4,5)15-11-13-16(23)14-12-15/h8-14H,24H2,1-7H3 |
| InChIKey | JJAQZWIRUHMPCM-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.39 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|