C23H28N2O4 — CID 102097440
(5S)-1,3-dicyclohexyl-5-[(2R)-3-oxo-1-benzofuran-2-yl]imidazolidine-2,4-dione (PubChem CID 102097440) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is (5S)-1,3-dicyclohexyl-5-[(2R)-3-oxo-1-benzofuran-2-yl]imidazolidine-2,4-dione.
| Compound Name | (5S)-1,3-dicyclohexyl-5-[(2R)-3-oxo-1-benzofuran-2-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 102097440 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | (5S)-1,3-dicyclohexyl-5-[(2R)-3-oxo-1-benzofuran-2-yl]imidazolidine-2,4-dione |
| SMILES | O=C1c2ccccc2O[C@@H]1[C@H]1C(=O)N(C2CCCCC2)C(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C23H28N2O4/c26-20-17-13-7-8-14-18(17)29-21(20)19-22(27)25(16-11-5-2-6-12-16)23(28)24(19)15-9-3-1-4-10-15/h7-8,13-16,19,21H,1-6,9-12H2/t19-,21+/m0/s1 |
| InChIKey | GLIXQQGDFFUFCR-PZJWPPBQSA-N |
| XLogP | 3.93 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|