C25H29N3O5 — CID 102097909
methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[2-(3-oxopropyl)-1-pyridin-2-ylindol-3-yl]propanoate (PubChem CID 102097909) has the molecular formula C25H29N3O5 and a molecular weight of 451.52 g/mol. Its IUPAC name is methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[2-(3-oxopropyl)-1-pyridin-2-ylindol-3-yl]propanoate.
| Compound Name | methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[2-(3-oxopropyl)-1-pyridin-2-ylindol-3-yl]propanoate |
|---|---|
| PubChem CID | 102097909 |
| Molecular Formula | C25H29N3O5 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[2-(3-oxopropyl)-1-pyridin-2-ylindol-3-yl]propanoate |
| SMILES | COC(=O)C(Cc1c(CCC=O)n(-c2ccccn2)c2ccccc12)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H29N3O5/c1-25(2,3)33-24(31)27-19(23(30)32-4)16-18-17-10-5-6-11-20(17)28(21(18)12-9-15-29)22-13-7-8-14-26-22/h5-8,10-11,13-15,19H,9,12,16H2,1-4H3,(H,27,31) |
| InChIKey | VKPOORKRBGXKBX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|