C20H23FN4O3 — CID 77456455
tert-butyl N-[1-(6-fluoro-1-pyridin-2-ylbenzimidazol-2-yl)-2-methoxyethyl]carbamate (PubChem CID 77456455) has the molecular formula C20H23FN4O3 and a molecular weight of 386.43 g/mol. Its IUPAC name is tert-butyl N-[1-(6-fluoro-1-pyridin-2-ylbenzimidazol-2-yl)-2-methoxyethyl]carbamate.
| Compound Name | tert-butyl N-[1-(6-fluoro-1-pyridin-2-ylbenzimidazol-2-yl)-2-methoxyethyl]carbamate |
|---|---|
| PubChem CID | 77456455 |
| Molecular Formula | C20H23FN4O3 |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | tert-butyl N-[1-(6-fluoro-1-pyridin-2-ylbenzimidazol-2-yl)-2-methoxyethyl]carbamate |
| SMILES | COCC(NC(=O)OC(C)(C)C)c1nc2ccc(F)cc2n1-c1ccccn1 |
| InChI | InChI=1S/C20H23FN4O3/c1-20(2,3)28-19(26)24-15(12-27-4)18-23-14-9-8-13(21)11-16(14)25(18)17-7-5-6-10-22-17/h5-11,15H,12H2,1-4H3,(H,24,26) |
| InChIKey | SNXSCAURYULCKE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |