C14H17FN2O2S — CID 73098567
tert-butyl N-[1-(6-fluoro-1,3-benzothiazol-2-yl)ethyl]carbamate (PubChem CID 73098567) has the molecular formula C14H17FN2O2S and a molecular weight of 296.37 g/mol. Its IUPAC name is tert-butyl N-[1-(6-fluoro-1,3-benzothiazol-2-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[1-(6-fluoro-1,3-benzothiazol-2-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 73098567 |
| Molecular Formula | C14H17FN2O2S |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | tert-butyl N-[1-(6-fluoro-1,3-benzothiazol-2-yl)ethyl]carbamate |
| SMILES | CC(NC(=O)OC(C)(C)C)c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C14H17FN2O2S/c1-8(16-13(18)19-14(2,3)4)12-17-10-6-5-9(15)7-11(10)20-12/h5-8H,1-4H3,(H,16,18) |
| InChIKey | BVHLGUBWXQMYKF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |