C17H13FN4OS — CID 51039137
1-(4-cyanophenyl)-3-[(1R)-1-(6-fluoro-1,3-benzothiazol-2-yl)ethyl]urea (PubChem CID 51039137) has the molecular formula C17H13FN4OS and a molecular weight of 340.38 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-3-[(1R)-1-(6-fluoro-1,3-benzothiazol-2-yl)ethyl]urea.
| Compound Name | 1-(4-cyanophenyl)-3-[(1R)-1-(6-fluoro-1,3-benzothiazol-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 51039137 |
| Molecular Formula | C17H13FN4OS |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 1-(4-cyanophenyl)-3-[(1R)-1-(6-fluoro-1,3-benzothiazol-2-yl)ethyl]urea |
| SMILES | C[C@@H](NC(=O)Nc1ccc(C#N)cc1)c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C17H13FN4OS/c1-10(16-22-14-7-4-12(18)8-15(14)24-16)20-17(23)21-13-5-2-11(9-19)3-6-13/h2-8,10H,1H3,(H2,20,21,23)/t10-/m1/s1 |
| InChIKey | WXIGTEGAFFJXSW-SNVBAGLBSA-N |
| XLogP | 4.19 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |