C19H19F8N3O3S — CID 71582958
2,2,3,3,4,4,4-heptafluorobutyl N-[(2S)-1-[[(1R)-1-(6-fluoro-1,3-benzothiazol-2-yl)ethyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 71582958) has the molecular formula C19H19F8N3O3S and a molecular weight of 521.43 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluorobutyl N-[(2S)-1-[[(1R)-1-(6-fluoro-1,3-benzothiazol-2-yl)ethyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | 2,2,3,3,4,4,4-heptafluorobutyl N-[(2S)-1-[[(1R)-1-(6-fluoro-1,3-benzothiazol-2-yl)ethyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 71582958 |
| Molecular Formula | C19H19F8N3O3S |
| Molecular Weight | 521.43 g/mol |
| Exact Mass | 521.10 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutyl N-[(2S)-1-[[(1R)-1-(6-fluoro-1,3-benzothiazol-2-yl)ethyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OCC(F)(F)C(F)(F)C(F)(F)F)C(=O)N[C@H](C)c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C19H19F8N3O3S/c1-8(2)13(30-16(32)33-7-17(21,22)18(23,24)19(25,26)27)14(31)28-9(3)15-29-11-5-4-10(20)6-12(11)34-15/h4-6,8-9,13H,7H2,1-3H3,(H,28,31)(H,30,32)/t9-,13+/m1/s1 |
| InChIKey | YJJMOLSEKJHYBL-RNCFNFMXSA-N |
| XLogP | 5.20 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.43 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|