C22H30FN3O3 — CID 123349458
tert-butyl N-[1-[6-fluoro-1-[3-(3-methoxycyclobutyl)prop-2-enyl]benzimidazol-2-yl]ethyl]carbamate (PubChem CID 123349458) has the molecular formula C22H30FN3O3 and a molecular weight of 403.50 g/mol. Its IUPAC name is tert-butyl N-[1-[6-fluoro-1-[3-(3-methoxycyclobutyl)prop-2-enyl]benzimidazol-2-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[1-[6-fluoro-1-[3-(3-methoxycyclobutyl)prop-2-enyl]benzimidazol-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 123349458 |
| Molecular Formula | C22H30FN3O3 |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | tert-butyl N-[1-[6-fluoro-1-[3-(3-methoxycyclobutyl)prop-2-enyl]benzimidazol-2-yl]ethyl]carbamate |
| SMILES | COC1CC(C=CCn2c(C(C)NC(=O)OC(C)(C)C)nc3ccc(F)cc32)C1 |
| InChI | InChI=1S/C22H30FN3O3/c1-14(24-21(27)29-22(2,3)4)20-25-18-9-8-16(23)13-19(18)26(20)10-6-7-15-11-17(12-15)28-5/h6-9,13-15,17H,10-12H2,1-5H3,(H,24,27) |
| InChIKey | DPXFCKPWBHLDHF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|