C12H17FN2O3 — CID 86657026
tert-butyl N-[(1R)-1-(5-fluoro-1-oxidopyridin-1-ium-2-yl)ethyl]carbamate (PubChem CID 86657026) has the molecular formula C12H17FN2O3 and a molecular weight of 256.28 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-(5-fluoro-1-oxidopyridin-1-ium-2-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-(5-fluoro-1-oxidopyridin-1-ium-2-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 86657026 |
| Molecular Formula | C12H17FN2O3 |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | tert-butyl N-[(1R)-1-(5-fluoro-1-oxidopyridin-1-ium-2-yl)ethyl]carbamate |
| SMILES | C[C@@H](NC(=O)OC(C)(C)C)c1ccc(F)c[n+]1[O-] |
| InChI | InChI=1S/C12H17FN2O3/c1-8(14-11(16)18-12(2,3)4)10-6-5-9(13)7-15(10)17/h5-8H,1-4H3,(H,14,16)/t8-/m1/s1 |
| InChIKey | HDFYJFCGHWWQAN-MRVPVSSYSA-N |
| XLogP | 2.04 |
| TPSA | 65.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|