C24H24OP+ — CID 102099076
[(3E)-5-methoxypenta-1,3-dien-2-yl]-triphenylphosphanium (PubChem CID 102099076) has the molecular formula C24H24OP+ and a molecular weight of 359.43 g/mol. Its IUPAC name is [(3E)-5-methoxypenta-1,3-dien-2-yl]-triphenylphosphanium.
| Compound Name | [(3E)-5-methoxypenta-1,3-dien-2-yl]-triphenylphosphanium |
|---|---|
| PubChem CID | 102099076 |
| Molecular Formula | C24H24OP+ |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | [(3E)-5-methoxypenta-1,3-dien-2-yl]-triphenylphosphanium |
| SMILES | C=C(/C=C/COC)[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H24OP/c1-21(13-12-20-25-2)26(22-14-6-3-7-15-22,23-16-8-4-9-17-23)24-18-10-5-11-19-24/h3-19H,1,20H2,2H3/q+1/b13-12+ |
| InChIKey | FFWBFXBGYKLBOR-OUKQBFOZSA-N |
| XLogP | 4.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|