C36H59N — CID 102100356
(1S,2S,5R,9S,10S,13S)-1,5-dimethyl-6-[(2R)-6-methylheptan-2-yl]-16,17-dipropyl-18-azapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-15,17,19-triene (PubChem CID 102100356) has the molecular formula C36H59N and a molecular weight of 505.88 g/mol. Its IUPAC name is (1S,2S,5R,9S,10S,13S)-1,5-dimethyl-6-[(2R)-6-methylheptan-2-yl]-16,17-dipropyl-18-azapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-15,17,19-triene.
| Compound Name | (1S,2S,5R,9S,10S,13S)-1,5-dimethyl-6-[(2R)-6-methylheptan-2-yl]-16,17-dipropyl-18-azapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-15,17,19-triene |
|---|---|
| PubChem CID | 102100356 |
| Molecular Formula | C36H59N |
| Molecular Weight | 505.88 g/mol |
| Exact Mass | 505.46 |
| IUPAC Name | (1S,2S,5R,9S,10S,13S)-1,5-dimethyl-6-[(2R)-6-methylheptan-2-yl]-16,17-dipropyl-18-azapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-15,17,19-triene |
| SMILES | CCCc1ncc2c(c1CCC)C[C@@H]1CC[C@H]3[C@H](CC[C@]4(C)C([C@H](C)CCCC(C)C)CC[C@@H]34)[C@@]1(C)C2 |
| InChI | InChI=1S/C36H59N/c1-8-11-28-30-21-27-15-16-29-32-18-17-31(25(5)14-10-13-24(3)4)35(32,6)20-19-33(29)36(27,7)22-26(30)23-37-34(28)12-9-2/h23-25,27,29,31-33H,8-22H2,1-7H3/t25-,27+,29-,31?,32+,33+,35-,36+/m1/s1 |
| InChIKey | CDQVYPIUUNLQCW-NRFUKZROSA-N |
| XLogP | 10.02 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.88 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |