C33H48N4 — CID 11272003
(1S,2S,5R,6R,9S,10R,13S)-17,19-diamino-1,5-dimethyl-6-[(2R)-6-methylheptan-2-yl]pentacyclo[11.8.0.02,10.05,9.015,20]henicosa-15(20),16,18-triene-16,18-dicarbonitrile (PubChem CID 11272003) has the molecular formula C33H48N4 and a molecular weight of 500.78 g/mol. Its IUPAC name is (1S,2S,5R,6R,9S,10R,13S)-17,19-diamino-1,5-dimethyl-6-[(2R)-6-methylheptan-2-yl]pentacyclo[11.8.0.02,10.05,9.015,20]henicosa-15(20),16,18-triene-16,18-dicarbonitrile.
| Compound Name | (1S,2S,5R,6R,9S,10R,13S)-17,19-diamino-1,5-dimethyl-6-[(2R)-6-methylheptan-2-yl]pentacyclo[11.8.0.02,10.05,9.015,20]henicosa-15(20),16,18-triene-16,18-dicarbonitrile |
|---|---|
| PubChem CID | 11272003 |
| Molecular Formula | C33H48N4 |
| Molecular Weight | 500.78 g/mol |
| Exact Mass | 500.39 |
| IUPAC Name | (1S,2S,5R,6R,9S,10R,13S)-17,19-diamino-1,5-dimethyl-6-[(2R)-6-methylheptan-2-yl]pentacyclo[11.8.0.02,10.05,9.015,20]henicosa-15(20),16,18-triene-16,18-dicarbonitrile |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4Cc5c(C#N)c(N)c(C#N)c(N)c5C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C33H48N4/c1-19(2)7-6-8-20(3)27-11-12-28-22-10-9-21-15-23-24(30(36)26(18-35)31(37)25(23)17-34)16-33(21,5)29(22)13-14-32(27,28)4/h19-22,27-29H,6-16,36-37H2,1-5H3/t20-,21+,22+,27-,28+,29+,32-,33+/m1/s1 |
| InChIKey | KWNIXAKVGQJYDN-QYWAYJGZSA-N |
| XLogP | 7.63 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.78 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|