C34H51N — CID 101278582
(1S,2S,5R,6R,9S,10R,13R)-1,5,20-trimethyl-6-[(2R)-6-methylheptan-2-yl]-16-azahexacyclo[11.11.0.02,10.05,9.015,23.017,22]tetracosa-15(23),17(22),18,20-tetraene (PubChem CID 101278582) has the molecular formula C34H51N and a molecular weight of 473.79 g/mol. Its IUPAC name is (1S,2S,5R,6R,9S,10R,13R)-1,5,20-trimethyl-6-[(2R)-6-methylheptan-2-yl]-16-azahexacyclo[11.11.0.02,10.05,9.015,23.017,22]tetracosa-15(23),17(22),18,20-tetraene.
| Compound Name | (1S,2S,5R,6R,9S,10R,13R)-1,5,20-trimethyl-6-[(2R)-6-methylheptan-2-yl]-16-azahexacyclo[11.11.0.02,10.05,9.015,23.017,22]tetracosa-15(23),17(22),18,20-tetraene |
|---|---|
| PubChem CID | 101278582 |
| Molecular Formula | C34H51N |
| Molecular Weight | 473.79 g/mol |
| Exact Mass | 473.40 |
| IUPAC Name | (1S,2S,5R,6R,9S,10R,13R)-1,5,20-trimethyl-6-[(2R)-6-methylheptan-2-yl]-16-azahexacyclo[11.11.0.02,10.05,9.015,23.017,22]tetracosa-15(23),17(22),18,20-tetraene |
| SMILES | Cc1ccc2[nH]c3c(c2c1)C[C@@]1(C)[C@H](CC[C@@H]2[C@@H]1CC[C@]1(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@@H]21)C3 |
| InChI | InChI=1S/C34H51N/c1-21(2)8-7-9-23(4)28-13-14-29-25-12-11-24-19-32-27(26-18-22(3)10-15-31(26)35-32)20-34(24,6)30(25)16-17-33(28,29)5/h10,15,18,21,23-25,28-30,35H,7-9,11-14,16-17,19-20H2,1-6H3/t23-,24-,25+,28-,29+,30+,33-,34+/m1/s1 |
| InChIKey | RXZVPRJFMIETQO-IXJJSTDCSA-N |
| XLogP | 9.51 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.79 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|