C36H52N4 — CID 134909108
(1S,2S,5R,6R,9S,10R,13S)-1,5-dimethyl-6-[(2R)-6-methylheptan-2-yl]-20-(1,2,4-triazol-1-ylmethyl)-16-azahexacyclo[11.11.0.02,10.05,9.015,23.017,22]tetracosa-15(23),17(22),18,20-tetraene (PubChem CID 134909108) has the molecular formula C36H52N4 and a molecular weight of 540.84 g/mol. Its IUPAC name is (1S,2S,5R,6R,9S,10R,13S)-1,5-dimethyl-6-[(2R)-6-methylheptan-2-yl]-20-(1,2,4-triazol-1-ylmethyl)-16-azahexacyclo[11.11.0.02,10.05,9.015,23.017,22]tetracosa-15(23),17(22),18,20-tetraene.
| Compound Name | (1S,2S,5R,6R,9S,10R,13S)-1,5-dimethyl-6-[(2R)-6-methylheptan-2-yl]-20-(1,2,4-triazol-1-ylmethyl)-16-azahexacyclo[11.11.0.02,10.05,9.015,23.017,22]tetracosa-15(23),17(22),18,20-tetraene |
|---|---|
| PubChem CID | 134909108 |
| Molecular Formula | C36H52N4 |
| Molecular Weight | 540.84 g/mol |
| Exact Mass | 540.42 |
| IUPAC Name | (1S,2S,5R,6R,9S,10R,13S)-1,5-dimethyl-6-[(2R)-6-methylheptan-2-yl]-20-(1,2,4-triazol-1-ylmethyl)-16-azahexacyclo[11.11.0.02,10.05,9.015,23.017,22]tetracosa-15(23),17(22),18,20-tetraene |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4Cc5[nH]c6ccc(Cn7cncn7)cc6c5C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C36H52N4/c1-23(2)7-6-8-24(3)30-12-13-31-27-11-10-26-18-34-29(19-36(26,5)32(27)15-16-35(30,31)4)28-17-25(9-14-33(28)39-34)20-40-22-37-21-38-40/h9,14,17,21-24,26-27,30-32,39H,6-8,10-13,15-16,18-20H2,1-5H3/t24-,26+,27+,30-,31+,32+,35-,36+/m1/s1 |
| InChIKey | SVUQAESHVDDMKL-PZDSWHNOSA-N |
| XLogP | 8.84 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.84 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|