C35H49NO2 — CID 635737
14,18-dimethyl-19-(6-methylheptan-2-yl)-11-nitrohexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosa-3,5,7,9,11-pentaene (PubChem CID 635737) has the molecular formula C35H49NO2 and a molecular weight of 515.78 g/mol. Its IUPAC name is 14,18-dimethyl-19-(6-methylheptan-2-yl)-11-nitrohexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosa-3,5,7,9,11-pentaene.
| Compound Name | 14,18-dimethyl-19-(6-methylheptan-2-yl)-11-nitrohexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosa-3,5,7,9,11-pentaene |
|---|---|
| PubChem CID | 635737 |
| Molecular Formula | C35H49NO2 |
| Molecular Weight | 515.78 g/mol |
| Exact Mass | 515.38 |
| IUPAC Name | 14,18-dimethyl-19-(6-methylheptan-2-yl)-11-nitrohexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosa-3,5,7,9,11-pentaene |
| SMILES | CC(C)CCCC(C)C1CCC2C3CCC4Cc5cc6ccccc6c([N+](=O)[O-])c5CC4(C)C3CCC12C |
| InChI | InChI=1S/C35H49NO2/c1-22(2)9-8-10-23(3)30-15-16-31-28-14-13-26-20-25-19-24-11-6-7-12-27(24)33(36(37)38)29(25)21-35(26,5)32(28)17-18-34(30,31)4/h6-7,11-12,19,22-23,26,28,30-32H,8-10,13-18,20-21H2,1-5H3 |
| InChIKey | MTCWMGHSWISXTL-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.78 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|