C36H55N — CID 11944784
(1S,2R,5R,6R,9S,10S,13S)-1,5-dimethyl-6-[(2S)-6-methylheptan-2-yl]-20-propan-2-yl-16-azahexacyclo[11.11.0.02,10.05,9.015,23.017,22]tetracosa-15(23),17(22),18,20-tetraene (PubChem CID 11944784) has the molecular formula C36H55N and a molecular weight of 501.84 g/mol. Its IUPAC name is (1S,2R,5R,6R,9S,10S,13S)-1,5-dimethyl-6-[(2S)-6-methylheptan-2-yl]-20-propan-2-yl-16-azahexacyclo[11.11.0.02,10.05,9.015,23.017,22]tetracosa-15(23),17(22),18,20-tetraene.
| Compound Name | (1S,2R,5R,6R,9S,10S,13S)-1,5-dimethyl-6-[(2S)-6-methylheptan-2-yl]-20-propan-2-yl-16-azahexacyclo[11.11.0.02,10.05,9.015,23.017,22]tetracosa-15(23),17(22),18,20-tetraene |
|---|---|
| PubChem CID | 11944784 |
| Molecular Formula | C36H55N |
| Molecular Weight | 501.84 g/mol |
| Exact Mass | 501.43 |
| IUPAC Name | (1S,2R,5R,6R,9S,10S,13S)-1,5-dimethyl-6-[(2S)-6-methylheptan-2-yl]-20-propan-2-yl-16-azahexacyclo[11.11.0.02,10.05,9.015,23.017,22]tetracosa-15(23),17(22),18,20-tetraene |
| SMILES | CC(C)CCC[C@H](C)[C@H]1CC[C@H]2[C@H]3CC[C@H]4Cc5[nH]c6ccc(C(C)C)cc6c5C[C@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C36H55N/c1-22(2)9-8-10-24(5)30-14-15-31-27-13-12-26-20-34-29(21-36(26,7)32(27)17-18-35(30,31)6)28-19-25(23(3)4)11-16-33(28)37-34/h11,16,19,22-24,26-27,30-32,37H,8-10,12-15,17-18,20-21H2,1-7H3/t24-,26-,27+,30+,31-,32+,35+,36-/m0/s1 |
| InChIKey | RWAOTMBZNGDZTI-VASWJJKESA-N |
| XLogP | 10.33 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.84 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|