C16H30O3Si — CID 102100733
(E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-oxodec-2-enal (PubChem CID 102100733) has the molecular formula C16H30O3Si and a molecular weight of 298.50 g/mol. Its IUPAC name is (E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-oxodec-2-enal.
| Compound Name | (E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-oxodec-2-enal |
|---|---|
| PubChem CID | 102100733 |
| Molecular Formula | C16H30O3Si |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | (E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-oxodec-2-enal |
| SMILES | CCCCC[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)/C=C/C=O |
| InChI | InChI=1S/C16H30O3Si/c1-7-8-9-12-15(14(18)11-10-13-17)19-20(5,6)16(2,3)4/h10-11,13,15H,7-9,12H2,1-6H3/b11-10+/t15-/m1/s1 |
| InChIKey | MRKBSVQBCYNKFN-AUECHBEKSA-N |
| XLogP | 4.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|