C18H34O4Si — CID 138979141
(Z,5R,11S)-5-[tert-butyl(dimethyl)silyl]oxy-11-hydroxy-4-oxododec-2-enal (PubChem CID 138979141) has the molecular formula C18H34O4Si and a molecular weight of 342.55 g/mol. Its IUPAC name is (Z,5R,11S)-5-[tert-butyl(dimethyl)silyl]oxy-11-hydroxy-4-oxododec-2-enal.
| Compound Name | (Z,5R,11S)-5-[tert-butyl(dimethyl)silyl]oxy-11-hydroxy-4-oxododec-2-enal |
|---|---|
| PubChem CID | 138979141 |
| Molecular Formula | C18H34O4Si |
| Molecular Weight | 342.55 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | (Z,5R,11S)-5-[tert-butyl(dimethyl)silyl]oxy-11-hydroxy-4-oxododec-2-enal |
| SMILES | C[C@H](O)CCCCC[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)/C=C\C=O |
| InChI | InChI=1S/C18H34O4Si/c1-15(20)11-8-7-9-13-17(16(21)12-10-14-19)22-23(5,6)18(2,3)4/h10,12,14-15,17,20H,7-9,11,13H2,1-6H3/b12-10-/t15-,17+/m0/s1 |
| InChIKey | RTPMDUFJUSOFIQ-PIFBBDKHSA-N |
| XLogP | 4.03 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.55 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|