C28H56O4Si2 — CID 138979140
(E,5R,7S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4-oxohexadec-2-enal (PubChem CID 138979140) has the molecular formula C28H56O4Si2 and a molecular weight of 512.92 g/mol. Its IUPAC name is (E,5R,7S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4-oxohexadec-2-enal.
| Compound Name | (E,5R,7S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4-oxohexadec-2-enal |
|---|---|
| PubChem CID | 138979140 |
| Molecular Formula | C28H56O4Si2 |
| Molecular Weight | 512.92 g/mol |
| Exact Mass | 512.37 |
| IUPAC Name | (E,5R,7S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4-oxohexadec-2-enal |
| SMILES | CCCCCCCCC[C@@H](C[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)/C=C/C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H56O4Si2/c1-12-13-14-15-16-17-18-20-24(31-33(8,9)27(2,3)4)23-26(25(30)21-19-22-29)32-34(10,11)28(5,6)7/h19,21-22,24,26H,12-18,20,23H2,1-11H3/b21-19+/t24-,26+/m0/s1 |
| InChIKey | AVMLXYQXQNLWJL-SAYIBJMZSA-N |
| XLogP | 8.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.92 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|