C18H20N2O2 — CID 102102156
(2R,6R,10S)-10-(hydroxymethyl)-9,19-diazapentacyclo[10.7.0.02,6.02,9.013,18]nonadeca-1(12),13,15,17-tetraen-8-one (PubChem CID 102102156) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is (2R,6R,10S)-10-(hydroxymethyl)-9,19-diazapentacyclo[10.7.0.02,6.02,9.013,18]nonadeca-1(12),13,15,17-tetraen-8-one.
| Compound Name | (2R,6R,10S)-10-(hydroxymethyl)-9,19-diazapentacyclo[10.7.0.02,6.02,9.013,18]nonadeca-1(12),13,15,17-tetraen-8-one |
|---|---|
| PubChem CID | 102102156 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | (2R,6R,10S)-10-(hydroxymethyl)-9,19-diazapentacyclo[10.7.0.02,6.02,9.013,18]nonadeca-1(12),13,15,17-tetraen-8-one |
| SMILES | O=C1C[C@H]2CCC[C@]23c2[nH]c4ccccc4c2C[C@@H](CO)N13 |
| InChI | InChI=1S/C18H20N2O2/c21-10-12-9-14-13-5-1-2-6-15(13)19-17(14)18-7-3-4-11(18)8-16(22)20(12)18/h1-2,5-6,11-12,19,21H,3-4,7-10H2/t11-,12+,18-/m1/s1 |
| InChIKey | MBDHFCKUPJPHOE-FTLABTOESA-N |
| XLogP | 2.31 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |