C26H29N3O2 — CID 101253033
(5S,11bR)-N-benzyl-11b-tert-butyl-3-oxo-2,5,6,11-tetrahydro-1H-indolizino[8,7-b]indole-5-carboxamide (PubChem CID 101253033) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is (5S,11bR)-N-benzyl-11b-tert-butyl-3-oxo-2,5,6,11-tetrahydro-1H-indolizino[8,7-b]indole-5-carboxamide.
| Compound Name | (5S,11bR)-N-benzyl-11b-tert-butyl-3-oxo-2,5,6,11-tetrahydro-1H-indolizino[8,7-b]indole-5-carboxamide |
|---|---|
| PubChem CID | 101253033 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | (5S,11bR)-N-benzyl-11b-tert-butyl-3-oxo-2,5,6,11-tetrahydro-1H-indolizino[8,7-b]indole-5-carboxamide |
| SMILES | CC(C)(C)[C@@]12CCC(=O)N1[C@H](C(=O)NCc1ccccc1)Cc1c2[nH]c2ccccc12 |
| InChI | InChI=1S/C26H29N3O2/c1-25(2,3)26-14-13-22(30)29(26)21(24(31)27-16-17-9-5-4-6-10-17)15-19-18-11-7-8-12-20(18)28-23(19)26/h4-12,21,28H,13-16H2,1-3H3,(H,27,31)/t21-,26-/m0/s1 |
| InChIKey | LLQMMQAJKSMDSW-LVXARBLLSA-N |
| XLogP | 4.27 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |