C17H19ClN2O — CID 71604834
(6S,12bR)-6-(chloromethyl)-12b-methyl-1,2,3,6,7,12-hexahydroindolo[2,3-a]quinolizin-4-one (PubChem CID 71604834) has the molecular formula C17H19ClN2O and a molecular weight of 302.80 g/mol. Its IUPAC name is (6S,12bR)-6-(chloromethyl)-12b-methyl-1,2,3,6,7,12-hexahydroindolo[2,3-a]quinolizin-4-one.
| Compound Name | (6S,12bR)-6-(chloromethyl)-12b-methyl-1,2,3,6,7,12-hexahydroindolo[2,3-a]quinolizin-4-one |
|---|---|
| PubChem CID | 71604834 |
| Molecular Formula | C17H19ClN2O |
| Molecular Weight | 302.80 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | (6S,12bR)-6-(chloromethyl)-12b-methyl-1,2,3,6,7,12-hexahydroindolo[2,3-a]quinolizin-4-one |
| SMILES | C[C@]12CCCC(=O)N1[C@H](CCl)Cc1c2[nH]c2ccccc12 |
| InChI | InChI=1S/C17H19ClN2O/c1-17-8-4-7-15(21)20(17)11(10-18)9-13-12-5-2-3-6-14(12)19-16(13)17/h2-3,5-6,11,19H,4,7-10H2,1H3/t11-,17+/m0/s1 |
| InChIKey | WXBRJYTUOSBDSC-APPDUMDISA-N |
| XLogP | 3.56 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.80 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|