C25H39NO6P2 — CID 102102974
N-tert-butyl-1,5-bis(dimethoxyphosphoryl)-2,4-diphenylpentan-3-amine (PubChem CID 102102974) has the molecular formula C25H39NO6P2 and a molecular weight of 511.54 g/mol. Its IUPAC name is N-tert-butyl-1,5-bis(dimethoxyphosphoryl)-2,4-diphenylpentan-3-amine.
| Compound Name | N-tert-butyl-1,5-bis(dimethoxyphosphoryl)-2,4-diphenylpentan-3-amine |
|---|---|
| PubChem CID | 102102974 |
| Molecular Formula | C25H39NO6P2 |
| Molecular Weight | 511.54 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | N-tert-butyl-1,5-bis(dimethoxyphosphoryl)-2,4-diphenylpentan-3-amine |
| SMILES | COP(=O)(CC(c1ccccc1)C(NC(C)(C)C)C(CP(=O)(OC)OC)c1ccccc1)OC |
| InChI | InChI=1S/C25H39NO6P2/c1-25(2,3)26-24(22(18-33(27,29-4)30-5)20-14-10-8-11-15-20)23(19-34(28,31-6)32-7)21-16-12-9-13-17-21/h8-17,22-24,26H,18-19H2,1-7H3 |
| InChIKey | LTLHCDGWGLGYIT-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.54 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|