C12H14F3NO — CID 102104027
N-[(1S)-2-ethoxy-1-phenylethyl]-2,2,2-trifluoroethanimine (PubChem CID 102104027) has the molecular formula C12H14F3NO and a molecular weight of 245.24 g/mol. Its IUPAC name is N-[(1S)-2-ethoxy-1-phenylethyl]-2,2,2-trifluoroethanimine.
| Compound Name | N-[(1S)-2-ethoxy-1-phenylethyl]-2,2,2-trifluoroethanimine |
|---|---|
| PubChem CID | 102104027 |
| Molecular Formula | C12H14F3NO |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | N-[(1S)-2-ethoxy-1-phenylethyl]-2,2,2-trifluoroethanimine |
| SMILES | CCOC[C@@H](/N=C/C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C12H14F3NO/c1-2-17-8-11(16-9-12(13,14)15)10-6-4-3-5-7-10/h3-7,9,11H,2,8H2,1H3/b16-9+/t11-/m1/s1 |
| InChIKey | KYCXPEGYUYOFIB-LKBVRNOZSA-N |
| XLogP | 3.40 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|