C30H20O16 — CID 102104044
7-[4-(3,5-dihydroxyphenoxy)-3,5-dihydroxyphenoxy]-3-(2,4,6-trihydroxyphenoxy)dibenzo-p-dioxin-1,2,6,8-tetrol (PubChem CID 102104044) has the molecular formula C30H20O16 and a molecular weight of 636.47 g/mol. Its IUPAC name is 7-[4-(3,5-dihydroxyphenoxy)-3,5-dihydroxyphenoxy]-3-(2,4,6-trihydroxyphenoxy)dibenzo-p-dioxin-1,2,6,8-tetrol.
| Compound Name | 7-[4-(3,5-dihydroxyphenoxy)-3,5-dihydroxyphenoxy]-3-(2,4,6-trihydroxyphenoxy)dibenzo-p-dioxin-1,2,6,8-tetrol |
|---|---|
| PubChem CID | 102104044 |
| Molecular Formula | C30H20O16 |
| Molecular Weight | 636.47 g/mol |
| Exact Mass | 636.08 |
| IUPAC Name | 7-[4-(3,5-dihydroxyphenoxy)-3,5-dihydroxyphenoxy]-3-(2,4,6-trihydroxyphenoxy)dibenzo-p-dioxin-1,2,6,8-tetrol |
| SMILES | Oc1cc(O)cc(Oc2c(O)cc(Oc3c(O)cc4c(c3O)Oc3cc(Oc5c(O)cc(O)cc5O)c(O)c(O)c3O4)cc2O)c1 |
| InChI | InChI=1S/C30H20O16/c31-10-1-11(32)3-13(2-10)42-26-17(36)6-14(7-18(26)37)43-28-19(38)8-21-30(25(28)41)46-22-9-20(23(39)24(40)29(22)45-21)44-27-15(34)4-12(33)5-16(27)35/h1-9,31-41H |
| InChIKey | JBIGPLLYWOCIMW-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 268.68 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.47 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|