C16H17ClO2 — CID 102104109
(2E,7E)-9-(4-chlorophenyl)-3-methyl-9-oxonona-2,7-dienal (PubChem CID 102104109) has the molecular formula C16H17ClO2 and a molecular weight of 276.76 g/mol. Its IUPAC name is (2E,7E)-9-(4-chlorophenyl)-3-methyl-9-oxonona-2,7-dienal.
| Compound Name | (2E,7E)-9-(4-chlorophenyl)-3-methyl-9-oxonona-2,7-dienal |
|---|---|
| PubChem CID | 102104109 |
| Molecular Formula | C16H17ClO2 |
| Molecular Weight | 276.76 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | (2E,7E)-9-(4-chlorophenyl)-3-methyl-9-oxonona-2,7-dienal |
| SMILES | C/C(=C\C=O)CCC/C=C/C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H17ClO2/c1-13(11-12-18)5-3-2-4-6-16(19)14-7-9-15(17)10-8-14/h4,6-12H,2-3,5H2,1H3/b6-4+,13-11+ |
| InChIKey | WFFINBFSJNVMMS-OACCZNHXSA-N |
| XLogP | 4.39 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.76 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|