C15H14O3 — CID 102105166
4a-methoxy-5-methyl-1,9a-dihydrofluorene-2,9-dione (PubChem CID 102105166) has the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. Its IUPAC name is 4a-methoxy-5-methyl-1,9a-dihydrofluorene-2,9-dione.
| Compound Name | 4a-methoxy-5-methyl-1,9a-dihydrofluorene-2,9-dione |
|---|---|
| PubChem CID | 102105166 |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 4a-methoxy-5-methyl-1,9a-dihydrofluorene-2,9-dione |
| SMILES | COC12C=CC(=O)CC1C(=O)c1cccc(C)c12 |
| InChI | InChI=1S/C15H14O3/c1-9-4-3-5-11-13(9)15(18-2)7-6-10(16)8-12(15)14(11)17/h3-7,12H,8H2,1-2H3 |
| InChIKey | GAUIGZXZMINDOX-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |