C14H11FO3 — CID 102105161
6-fluoro-4a-methoxy-1,9a-dihydrofluorene-2,9-dione (PubChem CID 102105161) has the molecular formula C14H11FO3 and a molecular weight of 246.24 g/mol. Its IUPAC name is 6-fluoro-4a-methoxy-1,9a-dihydrofluorene-2,9-dione.
| Compound Name | 6-fluoro-4a-methoxy-1,9a-dihydrofluorene-2,9-dione |
|---|---|
| PubChem CID | 102105161 |
| Molecular Formula | C14H11FO3 |
| Molecular Weight | 246.24 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 6-fluoro-4a-methoxy-1,9a-dihydrofluorene-2,9-dione |
| SMILES | COC12C=CC(=O)CC1C(=O)c1ccc(F)cc12 |
| InChI | InChI=1S/C14H11FO3/c1-18-14-5-4-9(16)7-12(14)13(17)10-3-2-8(15)6-11(10)14/h2-6,12H,7H2,1H3 |
| InChIKey | UACUACNBRNHPKN-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.24 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |