C10H9FO2S — CID 102972282
7-fluoro-2-methyl-1-oxo-2,3-dihydrothiochromen-4-one (PubChem CID 102972282) has the molecular formula C10H9FO2S and a molecular weight of 212.24 g/mol. Its IUPAC name is 7-fluoro-2-methyl-1-oxo-2,3-dihydrothiochromen-4-one.
| Compound Name | 7-fluoro-2-methyl-1-oxo-2,3-dihydrothiochromen-4-one |
|---|---|
| PubChem CID | 102972282 |
| Molecular Formula | C10H9FO2S |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | 7-fluoro-2-methyl-1-oxo-2,3-dihydrothiochromen-4-one |
| SMILES | CC1CC(=O)c2ccc(F)cc2S1=O |
| InChI | InChI=1S/C10H9FO2S/c1-6-4-9(12)8-3-2-7(11)5-10(8)14(6)13/h2-3,5-6H,4H2,1H3 |
| InChIKey | YQYVNPYETVTLKF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |