C14H11ClO3 — CID 102105163
5-chloro-4a-methoxy-1,9a-dihydrofluorene-2,9-dione (PubChem CID 102105163) has the molecular formula C14H11ClO3 and a molecular weight of 262.69 g/mol. Its IUPAC name is 5-chloro-4a-methoxy-1,9a-dihydrofluorene-2,9-dione.
| Compound Name | 5-chloro-4a-methoxy-1,9a-dihydrofluorene-2,9-dione |
|---|---|
| PubChem CID | 102105163 |
| Molecular Formula | C14H11ClO3 |
| Molecular Weight | 262.69 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 5-chloro-4a-methoxy-1,9a-dihydrofluorene-2,9-dione |
| SMILES | COC12C=CC(=O)CC1C(=O)c1cccc(Cl)c12 |
| InChI | InChI=1S/C14H11ClO3/c1-18-14-6-5-8(16)7-10(14)13(17)9-3-2-4-11(15)12(9)14/h2-6,10H,7H2,1H3 |
| InChIKey | AXNXELVOLDFVTH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.69 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |