C13H15N3O6S2 — CID 102105619
(2R)-2-[[5-[[(1R)-1-carboxy-2-sulfanylethyl]carbamoyl]pyridine-3-carbonyl]amino]-3-sulfanylpropanoic acid (PubChem CID 102105619) has the molecular formula C13H15N3O6S2 and a molecular weight of 373.41 g/mol. Its IUPAC name is (2R)-2-[[5-[[(1R)-1-carboxy-2-sulfanylethyl]carbamoyl]pyridine-3-carbonyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[[5-[[(1R)-1-carboxy-2-sulfanylethyl]carbamoyl]pyridine-3-carbonyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 102105619 |
| Molecular Formula | C13H15N3O6S2 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | (2R)-2-[[5-[[(1R)-1-carboxy-2-sulfanylethyl]carbamoyl]pyridine-3-carbonyl]amino]-3-sulfanylpropanoic acid |
| SMILES | O=C(N[C@@H](CS)C(=O)O)c1cncc(C(=O)N[C@@H](CS)C(=O)O)c1 |
| InChI | InChI=1S/C13H15N3O6S2/c17-10(15-8(4-23)12(19)20)6-1-7(3-14-2-6)11(18)16-9(5-24)13(21)22/h1-3,8-9,23-24H,4-5H2,(H,15,17)(H,16,18)(H,19,20)(H,21,22)/t8-,9-/m0/s1 |
| InChIKey | JTHWUTGNPNTCTM-IUCAKERBSA-N |
| XLogP | -0.69 |
| TPSA | 145.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|