C31H29N2O2+ — CID 102107303
1,3-bis(4-ethoxyphenyl)-4,5-diphenylimidazol-1-ium (PubChem CID 102107303) has the molecular formula C31H29N2O2+ and a molecular weight of 461.59 g/mol. Its IUPAC name is 1,3-bis(4-ethoxyphenyl)-4,5-diphenylimidazol-1-ium.
| Compound Name | 1,3-bis(4-ethoxyphenyl)-4,5-diphenylimidazol-1-ium |
|---|---|
| PubChem CID | 102107303 |
| Molecular Formula | C31H29N2O2+ |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | 1,3-bis(4-ethoxyphenyl)-4,5-diphenylimidazol-1-ium |
| SMILES | CCOc1ccc(-n2c[n+](-c3ccc(OCC)cc3)c(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H29N2O2/c1-3-34-28-19-15-26(16-20-28)32-23-33(27-17-21-29(22-18-27)35-4-2)31(25-13-9-6-10-14-25)30(32)24-11-7-5-8-12-24/h5-23H,3-4H2,1-2H3/q+1 |
| InChIKey | SOTJYKLIMHMAJN-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 27.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|