C27H28N3O+ — CID 163409445
1-(4-ethoxyphenyl)-3-(4-phenylphenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a][1,3]diazepin-4-ium (PubChem CID 163409445) has the molecular formula C27H28N3O+ and a molecular weight of 410.54 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-3-(4-phenylphenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a][1,3]diazepin-4-ium.
| Compound Name | 1-(4-ethoxyphenyl)-3-(4-phenylphenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a][1,3]diazepin-4-ium |
|---|---|
| PubChem CID | 163409445 |
| Molecular Formula | C27H28N3O+ |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 1-(4-ethoxyphenyl)-3-(4-phenylphenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a][1,3]diazepin-4-ium |
| SMILES | CCOc1ccc(-n2cc(-c3ccc(-c4ccccc4)cc3)[n+]3c2NCCCC3)cc1 |
| InChI | InChI=1S/C27H27N3O/c1-2-31-25-16-14-24(15-17-25)30-20-26(29-19-7-6-18-28-27(29)30)23-12-10-22(11-13-23)21-8-4-3-5-9-21/h3-5,8-17,20H,2,6-7,18-19H2,1H3/p+1 |
| InChIKey | LHDYMNPYKFXLGY-UHFFFAOYSA-O |
| XLogP | 5.70 |
| TPSA | 30.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|