C7H16N2OS2 — CID 102109242
3-amino-N,N-bis(2-sulfanylethyl)propanamide (PubChem CID 102109242) has the molecular formula C7H16N2OS2 and a molecular weight of 208.35 g/mol. Its IUPAC name is 3-amino-N,N-bis(2-sulfanylethyl)propanamide.
| Compound Name | 3-amino-N,N-bis(2-sulfanylethyl)propanamide |
|---|---|
| PubChem CID | 102109242 |
| Molecular Formula | C7H16N2OS2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 3-amino-N,N-bis(2-sulfanylethyl)propanamide |
| SMILES | NCCC(=O)N(CCS)CCS |
| InChI | InChI=1S/C7H16N2OS2/c8-2-1-7(10)9(3-5-11)4-6-12/h11-12H,1-6,8H2 |
| InChIKey | BEPSBKDWEWZNIW-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|