C5H14N2O7P2 — CID 140554532
[3-aminopropanoyl(phosphonomethyl)amino]methylphosphonic acid (PubChem CID 140554532) has the molecular formula C5H14N2O7P2 and a molecular weight of 276.12 g/mol. Its IUPAC name is [3-aminopropanoyl(phosphonomethyl)amino]methylphosphonic acid.
| Compound Name | [3-aminopropanoyl(phosphonomethyl)amino]methylphosphonic acid |
|---|---|
| PubChem CID | 140554532 |
| Molecular Formula | C5H14N2O7P2 |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | [3-aminopropanoyl(phosphonomethyl)amino]methylphosphonic acid |
| SMILES | NCCC(=O)N(CP(=O)(O)O)CP(=O)(O)O |
| InChI | InChI=1S/C5H14N2O7P2/c6-2-1-5(8)7(3-15(9,10)11)4-16(12,13)14/h1-4,6H2,(H2,9,10,11)(H2,12,13,14) |
| InChIKey | CEELDJQBCAEXSN-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|